Products 2360230-90-4
CAS 2360230-90-4 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)tetrahydrofuran-2-carboxylic acid, 95%, 95%, 2-(3,5-Dichlorophenyl)tetrahydrofuran-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-(3,5-dichlorophenyl)oxolane-2-carboxylic acid (CAS 2360230-90-4) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)oxolane-2-carboxylic acid. InChIKey: JRDFJGOZNIVJLM-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O3 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)oxolane-2-carboxylic acid |
| InChIKey | JRDFJGOZNIVJLM-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)(C2=CC(=CC(=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)