Products 2918932-28-0
CAS 2918932-28-0 is the registry number for 2,6-dichloro-3-(2-methyl-1,3-dioxolan-2-yl)benzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-3-(2-methyl-1,3-dioxolan-2-yl)benzaldehyde (CAS 2918932-28-0) is a chemical compound with the molecular formula C11H10Cl2O3 and a molecular weight of 261.10 g/mol. IUPAC name: 2,6-dichloro-3-(2-methyl-1,3-dioxolan-2-yl)benzaldehyde. InChIKey: GNZDHGXLJLNWAK-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O3 |
|---|---|
| Molecular weight | 261.10 g/mol |
| IUPAC name | 2,6-dichloro-3-(2-methyl-1,3-dioxolan-2-yl)benzaldehyde |
| InChIKey | GNZDHGXLJLNWAK-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C(=C(C=C2)Cl)C=O)Cl |
Computed by PubChem (NCBI)