CAS 236110-81-9 is the registry number for (S)-(+)-4-Benzyl-3-benzyloxyacetyl-2-oxazolidinone. Offered by: TRC. Available pack sizes: 500mg, 5g.
(4S)-4-benzyl-3-(2-phenylmethoxyacetyl)-1,3-oxazolidin-2-one (CAS 236110-81-9) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (4S)-4-benzyl-3-(2-phenylmethoxyacetyl)-1,3-oxazolidin-2-one. InChIKey: LIPRFZHBWBIVOM-KRWDZBQOSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4S)-4-benzyl-3-(2-phenylmethoxyacetyl)-1,3-oxazolidin-2-one |
| InChIKey | LIPRFZHBWBIVOM-KRWDZBQOSA-N |
| SMILES | C1[C@@H](N(C(=O)O1)C(=O)COCC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)