Products 2361625-37-6
CAS 2361625-37-6 is the registry number for Methyl (2R)-2-amino-2-{bicyclo(4.1.0)hept-3-en-3-yl}acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2R)-2-amino-2-(3-bicyclo[4.1.0]hept-3-enyl)acetate;hydrochloride (CAS 2361625-37-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: methyl (2R)-2-amino-2-(3-bicyclo[4.1.0]hept-3-enyl)acetate;hydrochloride. InChIKey: MPYDOGASXLONMI-DDGPOADKSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(3-bicyclo[4.1.0]hept-3-enyl)acetate;hydrochloride |
| InChIKey | MPYDOGASXLONMI-DDGPOADKSA-N |
| SMILES | COC(=O)[C@@H](C1=CCC2CC2C1)N.Cl |
Computed by PubChem (NCBI)