CAS 2361657-62-5 is the registry number for rac-tert-butyl N-[(1R,3S)-3-(aminomethyl)cyclopentyl]carbamate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1R,3S)-3-(aminomethyl)cyclopentyl]carbamate;hydrochloride (CAS 2361657-62-5) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-(aminomethyl)cyclopentyl]carbamate;hydrochloride. InChIKey: RIRHVQYIMKRANH-OULXEKPRSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-(aminomethyl)cyclopentyl]carbamate;hydrochloride |
| InChIKey | RIRHVQYIMKRANH-OULXEKPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](C1)CN.Cl |
Computed by PubChem (NCBI)