Products 2940961-91-9

CAS 2940961-91-9 is the registry number for tert-butyl N-[3-(aminomethyl)cyclopentyl]carbamate,hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-[3-(aminomethyl)cyclopentyl]carbamate;hydrochloride (CAS 2940961-91-9) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-[3-(aminomethyl)cyclopentyl]carbamate;hydrochloride. InChIKey: RIRHVQYIMKRANH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23ClN2O2
Molecular weight250.76 g/mol
IUPAC nametert-butyl N-[3-(aminomethyl)cyclopentyl]carbamate;hydrochloride
InChIKeyRIRHVQYIMKRANH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCC(C1)CN.Cl

Computed by PubChem (NCBI)