Products 236418-01-2
CAS 236418-01-2 appears in our catalog under these names: 1-(4-Chlorophenyl)-4-methylpentan-1-one, 95%, 1-(4-Chlorophenyl)-4-methylpentan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-chlorophenyl)-4-methylpentan-1-one (CAS 236418-01-2) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-chlorophenyl)-4-methylpentan-1-one. InChIKey: MOMILWVUQFINQM-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-4-methylpentan-1-one |
| InChIKey | MOMILWVUQFINQM-UHFFFAOYSA-N |
| SMILES | CC(C)CCC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)