Products 2368909-28-6
CAS 2368909-28-6 is the registry number for 8-chloro-1H-pyrido[3,4-d]pyrimidine-2,4-dione, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
8-chloro-1H-pyrido[3,4-d]pyrimidine-2,4-dione (CAS 2368909-28-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 8-chloro-1H-pyrido[3,4-d]pyrimidine-2,4-dione. InChIKey: VITJJDGGYCYFPR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 8-chloro-1H-pyrido[3,4-d]pyrimidine-2,4-dione |
| InChIKey | VITJJDGGYCYFPR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=O)NC(=O)N2)Cl |
Computed by PubChem (NCBI)