Products 2374238-06-7
CAS 2374238-06-7 is the registry number for Methyl 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylate (CAS 2374238-06-7) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylate. InChIKey: KXECTQUBZLDELN-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)bicyclo[1.1.0]butane-1-carboxylate |
| InChIKey | KXECTQUBZLDELN-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC1(C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)