CAS 2089651-62-5 appears in our catalog under these names: 3-(4-Fluorophenyl)bicyclo(1.1.1)pentane-1-carboxylic acid, 98%, 3-(4-Fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic Acid, >97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg.
3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2089651-62-5) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: LNZNWYLJIJZKBY-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | LNZNWYLJIJZKBY-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)