CAS 15851-94-2 is the registry number for 3-[(4-Fluorophenyl)methylidene]pentane-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(4-fluorophenyl)methylidene]pentane-2,4-dione (CAS 15851-94-2) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 3-[(4-fluorophenyl)methylidene]pentane-2,4-dione. InChIKey: GOHOMOOLOBVXQM-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methylidene]pentane-2,4-dione |
| InChIKey | GOHOMOOLOBVXQM-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=CC1=CC=C(C=C1)F)C(=O)C |
Computed by PubChem (NCBI)