CAS 762243-25-4 appears in our catalog under these names: 5-(3-Fluorophenyl)cyclohexane-1,3-dione, 95%, 5-(3-Fluorophenyl)cyclohexane-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5-(3-fluorophenyl)cyclohexane-1,3-dione (CAS 762243-25-4) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 5-(3-fluorophenyl)cyclohexane-1,3-dione. InChIKey: GCITYZWCVPHSGE-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 5-(3-fluorophenyl)cyclohexane-1,3-dione |
| InChIKey | GCITYZWCVPHSGE-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)