CAS 2648962-09-6 appears in our catalog under these names: 2-Fluoro-3-phenylbicyclo(1.1.1)pentane-1-carboxylic acid, 98%, (1s,3s)-2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2648962-09-6) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: QHYJFZPYGKHTKF-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 2-fluoro-3-phenylbicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | QHYJFZPYGKHTKF-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2F)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)