Products 1980053-59-5
CAS 1980053-59-5 is the registry number for 4-(3-Fluorobicyclo[1.1.1]pentan-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3-fluoro-1-bicyclo[1.1.1]pentanyl)benzoic acid (CAS 1980053-59-5) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 4-(3-fluoro-1-bicyclo[1.1.1]pentanyl)benzoic acid. InChIKey: YVRBXGQJCDIKRL-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 4-(3-fluoro-1-bicyclo[1.1.1]pentanyl)benzoic acid |
| InChIKey | YVRBXGQJCDIKRL-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)F)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)