Products 1600862-20-1
CAS 1600862-20-1 is the registry number for 5'-Fluoro-2',3'-dihydrospiro[cyclopropane-1,1'-indene]-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluorospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid (CAS 1600862-20-1) is a chemical compound with the molecular formula C12H11FO2 and a molecular weight of 206.21 g/mol. IUPAC name: 6-fluorospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: CIFXQHBWQOYQHY-UHFFFAOYSA-N.
| Molecular formula | C12H11FO2 |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 6-fluorospiro[1,2-dihydroindene-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | CIFXQHBWQOYQHY-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2C(=O)O)C3=C1C=C(C=C3)F |
Computed by PubChem (NCBI)