Products 2375262-37-4
CAS 2375262-37-4 is the registry number for 2-Fluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-fluoro-1-(2-fluorophenyl)ethanamine;hydrochloride (CAS 2375262-37-4) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 2-fluoro-1-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: SKGJROZGBHHJRM-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 2-fluoro-1-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | SKGJROZGBHHJRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CF)N)F.Cl |
Computed by PubChem (NCBI)