Products 2377034-25-6
CAS 2377034-25-6 is the registry number for 5H,7H,8H-Pyrano(4,3-c)pyridazine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carboxylic acid;hydrochloride (CAS 2377034-25-6) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carboxylic acid;hydrochloride. InChIKey: WBPQZGSYYPYEIH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 7,8-dihydro-5H-pyrano[4,3-c]pyridazine-3-carboxylic acid;hydrochloride |
| InChIKey | WBPQZGSYYPYEIH-UHFFFAOYSA-N |
| SMILES | C1COCC2=CC(=NN=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)