Products 2377034-90-5
CAS 2377034-90-5 is the registry number for 2-Oxabicyclo(2.1.1)hexane-1,4-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-oxabicyclo[2.1.1]hexane-1,4-dicarboxylic acid (CAS 2377034-90-5) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 2-oxabicyclo[2.1.1]hexane-1,4-dicarboxylic acid. InChIKey: OUVLCPWXCUVGPJ-UHFFFAOYSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-oxabicyclo[2.1.1]hexane-1,4-dicarboxylic acid |
| InChIKey | OUVLCPWXCUVGPJ-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(OC2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)