Products 2377036-30-9

CAS 2377036-30-9 is the registry number for 2,2-Dioxo-2λâ¶-thiabicyclo(2.1.1)hexane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2-dioxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2377036-30-9) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: 2,2-dioxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: XKCWAUKEPHYEPM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8O4S
Molecular weight176.19 g/mol
IUPAC name2,2-dioxo-2lambda6-thiabicyclo[2.1.1]hexane-4-carboxylic acid
InChIKeyXKCWAUKEPHYEPM-UHFFFAOYSA-N
SMILESC1C2CC1(CS2(=O)=O)C(=O)O

Computed by PubChem (NCBI)