Products 2377278-36-7
CAS 2377278-36-7 appears in our catalog under these names: Cabozantinib Impurity 5, 4-Chloro-6,7-dimethoxyquinoline 1-oxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6,7-dimethoxy-1-oxidoquinolin-1-ium (CAS 2377278-36-7) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 4-chloro-6,7-dimethoxy-1-oxidoquinolin-1-ium. InChIKey: NHDZCCNVRDQJQU-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 4-chloro-6,7-dimethoxy-1-oxidoquinolin-1-ium |
| InChIKey | NHDZCCNVRDQJQU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C[N+](=C2C=C1OC)[O-])Cl |
Computed by PubChem (NCBI)