Products 2379795-13-6
CAS 2379795-13-6 is the registry number for (R)-6-Bromo-3-methyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-6-bromo-3-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 2379795-13-6) is a chemical compound with the molecular formula C8H7BrN2O2 and a molecular weight of 243.06 g/mol. IUPAC name: (3R)-6-bromo-3-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: JWXILOKWKJYSDU-SCSAIBSYSA-N.
| Molecular formula | C8H7BrN2O2 |
|---|---|
| Molecular weight | 243.06 g/mol |
| IUPAC name | (3R)-6-bromo-3-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | JWXILOKWKJYSDU-SCSAIBSYSA-N |
| SMILES | C[C@@H]1C(=O)NC2=C(O1)N=C(C=C2)Br |
Computed by PubChem (NCBI)