Products 2382130-47-2
CAS 2382130-47-2 is the registry number for (2S)-3,3-dimethyl-2-pyrazol-1-yl-butanoic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(2S)-3,3-dimethyl-2-pyrazol-1-ylbutanoic acid (CAS 2382130-47-2) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-pyrazol-1-ylbutanoic acid. InChIKey: WXDIBMRBQWQKCK-SSDOTTSWSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-pyrazol-1-ylbutanoic acid |
| InChIKey | WXDIBMRBQWQKCK-SSDOTTSWSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)N1C=CC=N1 |
Computed by PubChem (NCBI)