CAS 2383945-27-3 is the registry number for 3-acetyl-2,6-dichlorobenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-acetyl-2,6-dichlorobenzaldehyde (CAS 2383945-27-3) is a chemical compound with the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. IUPAC name: 3-acetyl-2,6-dichlorobenzaldehyde. InChIKey: WBRDRJMMDIDDBA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2O2 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 3-acetyl-2,6-dichlorobenzaldehyde |
| InChIKey | WBRDRJMMDIDDBA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)