CAS 2413847-14-8 is the registry number for (S)-4-(tert-Butoxycarbonyl)-2,2-dimethylthiomorpholine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-3-carboxylic acid (CAS 2413847-14-8) is a chemical compound with the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. IUPAC name: (3S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-3-carboxylic acid. InChIKey: DZKMGYZIESQLPP-QMMMGPOBSA-N.
| Molecular formula | C12H21NO4S |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | (3S)-2,2-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]thiomorpholine-3-carboxylic acid |
| InChIKey | DZKMGYZIESQLPP-QMMMGPOBSA-N |
| SMILES | CC1([C@@H](N(CCS1)C(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)