Products 2384828-08-2
CAS 2384828-08-2 is the registry number for 1,3-Dibromo-2-methoxy-5-(trifluoromethyl)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-dibromo-2-methoxy-5-(trifluoromethyl)benzene (CAS 2384828-08-2) is a chemical compound with the molecular formula C8H5Br2F3O and a molecular weight of 333.93 g/mol. IUPAC name: 1,3-dibromo-2-methoxy-5-(trifluoromethyl)benzene. InChIKey: OJMAUNQLSUUQNM-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3O |
|---|---|
| Molecular weight | 333.93 g/mol |
| IUPAC name | 1,3-dibromo-2-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | OJMAUNQLSUUQNM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)