Products 240407-53-8
CAS 240407-53-8 is the registry number for Thymidine-13C-1. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 1 mg, 50 mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (CAS 240407-53-8) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 243.22 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione. InChIKey: IQFYYKKMVGJFEH-CJLSWCASSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 243.22 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxy(113C)methyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChIKey | IQFYYKKMVGJFEH-CJLSWCASSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)[13CH2]O)O |
Computed by PubChem (NCBI)