CAS 2407719-41-7 appears in our catalog under these names: 6-Bromo-2H-spiro(benzofuran-3,4'-oxazolidin)-2'-one, 97%, 6-bromospiro[2H-benzofuran-3,4'-oxazolidine]-2'-one, 97%, 97%, 6-BROMOSPIRO[2H-BENZOFURAN-3,4'-OXAZOLIDINE]-2'-ONE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one (CAS 2407719-41-7) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one. InChIKey: VMNNSZOUKRUDRI-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one |
| InChIKey | VMNNSZOUKRUDRI-UHFFFAOYSA-N |
| SMILES | C1C2(COC(=O)N2)C3=C(O1)C=C(C=C3)Br |
Computed by PubChem (NCBI)