CAS 2845283-36-3 is the registry number for (R)-6-Bromo-2H-spiro[benzofuran-3,4'-oxazolidin]-2'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one (CAS 2845283-36-3) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: (4R)-6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one. InChIKey: VMNNSZOUKRUDRI-SNVBAGLBSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | (4R)-6'-bromospiro[1,3-oxazolidine-4,3'-2H-1-benzofuran]-2-one |
| InChIKey | VMNNSZOUKRUDRI-SNVBAGLBSA-N |
| SMILES | C1[C@@]2(COC(=O)N2)C3=C(O1)C=C(C=C3)Br |
Computed by PubChem (NCBI)