Products 2409072-27-9
CAS 2409072-27-9 is the registry number for HDAC6-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-hydroxy-3-[6-(4-methoxyphenoxy)quinolin-2-yl]prop-2-enamide (CAS 2409072-27-9) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (E)-N-hydroxy-3-[6-(4-methoxyphenoxy)quinolin-2-yl]prop-2-enamide. InChIKey: VIDKIEAXAKFSHN-NYYWCZLTSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[6-(4-methoxyphenoxy)quinolin-2-yl]prop-2-enamide |
| InChIKey | VIDKIEAXAKFSHN-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC3=C(C=C2)N=C(C=C3)/C=C/C(=O)NO |
Computed by PubChem (NCBI)