Products 2411741-01-8
CAS 2411741-01-8 is the registry number for Antituberculosis agent-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(azetidin-1-ylmethyl)-6-hydroxy-2-(4-hydroxyphenyl)chromen-4-one (CAS 2411741-01-8) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: 5-(azetidin-1-ylmethyl)-6-hydroxy-2-(4-hydroxyphenyl)chromen-4-one. InChIKey: YONQTMXRNDKBLV-UHFFFAOYSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 5-(azetidin-1-ylmethyl)-6-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| InChIKey | YONQTMXRNDKBLV-UHFFFAOYSA-N |
| SMILES | C1CN(C1)CC2=C(C=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
Antituberculosis agent-2, orb1689154