Products 24161-38-4
CAS 24161-38-4 appears in our catalog under these names: 2-(5-Chloro-2-hydroxyphenyl)acetic acid 95%, 2-(5-Chloro-2-hydroxyphenyl)acetic acid, 95%, 95%, 2-(5-Chloro-2-hydroxyphenyl)acetic acid, ≥95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(5-chloro-2-hydroxyphenyl)acetic acid (CAS 24161-38-4) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(5-chloro-2-hydroxyphenyl)acetic acid. InChIKey: MXOUPSVVAIWFKQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(5-chloro-2-hydroxyphenyl)acetic acid |
| InChIKey | MXOUPSVVAIWFKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(5-chloro-2-hydroxyphenyl)acetic acid, 5-chloro-2-hydroxyphenylacetic acid, (5-chloro-2-hydroxyphenyl)acetic acid, Benzeneacetic acid,5-chloro-2-hydroxy-, (5-chloro-2-hydroxy-phenyl)-acetic acid, 5-Chloro-2-hydroxybenzeneacetic acid, NCIStruc1_000133, NCIStruc2_000241, MXOUPSVVAIWFKQ-UHFFFAOYSA-N, 2-(5-chloro-2-hydroxyphenyl)aceticacid