CAS 2416235-87-3 is the registry number for 5-Hydroxy-2-(2-oxopiperidin-3-yl)isoindoline-1,3-dione, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5-hydroxy-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione (CAS 2416235-87-3) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 5-hydroxy-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: NEBVIJWQHLFAMK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 5-hydroxy-2-(2-oxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | NEBVIJWQHLFAMK-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)NC1)N2C(=O)C3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)