Products 2417258-71-8
CAS 2417258-71-8 is the registry number for (R)-3-(5-Hydroxy-1-oxoisoindolin-2-yl)piperidine-2,6-dione 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(3R)-3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2417258-71-8) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: (3R)-3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: JJUMFQGCQAUIFH-SNVBAGLBSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | (3R)-3-(6-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | JJUMFQGCQAUIFH-SNVBAGLBSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N2CC3=C(C2=O)C=CC(=C3)O |
Computed by PubChem (NCBI)