Products 2418595-98-7
CAS 2418595-98-7 appears in our catalog under these names: (S)-5-Chloroindoline-2-carboxylic acid hydrochloride, 98%, (2S)-5-Chloro-2,3-dihydro-1h-indole-2-carboxylic acid hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride (CAS 2418595-98-7) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride. InChIKey: BYKPWTMONIIYRW-QRPNPIFTSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (2S)-5-chloro-2,3-dihydro-1H-indole-2-carboxylic acid;hydrochloride |
| InChIKey | BYKPWTMONIIYRW-QRPNPIFTSA-N |
| SMILES | C1[C@H](NC2=C1C=C(C=C2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)