Products 24192-17-4
CAS 24192-17-4 is the registry number for Apomorphine p-Quinone. Offered by: TRC, Mikromol. Available pack sizes: 10mg, 2,5mg, 25mg.
6-hydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione (CAS 24192-17-4) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 6-hydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione. InChIKey: AXNFTZZNUAGMDP-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 6-hydroxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione |
| InChIKey | AXNFTZZNUAGMDP-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C3C1=CC4=C(C3=CC=C2)C(=O)C(=O)C=C4O |
Computed by PubChem (NCBI)