CAS 24202-74-2 appears in our catalog under these names: 4-(Methoxycarbonyl)nicotinic acid, 4-(Methoxycarbonyl)nicotinic acid 98%, 3,4-Pyridinedicarboxylic acid, 4-methyl ester, 98%, 98%, 4-(Methoxycarbonyl)nicotinic acid, 90%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 100g, 10g, 50g.
4-methoxycarbonylpyridine-3-carboxylic acid (CAS 24202-74-2) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-methoxycarbonylpyridine-3-carboxylic acid. InChIKey: QLOYEIURVSRKOV-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-methoxycarbonylpyridine-3-carboxylic acid |
| InChIKey | QLOYEIURVSRKOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NC=C1)C(=O)O |
Computed by PubChem (NCBI)