Products 2422137-06-0

CAS 2422137-06-0 is the registry number for 3-[4-(2-Propyn-1-yloxy)phenyl]-2H-azirine. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

3-(4-prop-2-ynoxyphenyl)-2H-azirine (CAS 2422137-06-0) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 3-(4-prop-2-ynoxyphenyl)-2H-azirine. InChIKey: QDMVCUAYFOASAL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO
Molecular weight171.19 g/mol
IUPAC name3-(4-prop-2-ynoxyphenyl)-2H-azirine
InChIKeyQDMVCUAYFOASAL-UHFFFAOYSA-N
SMILESC#CCOC1=CC=C(C=C1)C2=NC2

Computed by PubChem (NCBI)