Products 24246-92-2
CAS 24246-92-2 is the registry number for 3-((2-Oxo-2-phenylethyl)carbamoyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-oxo-4-(phenacylamino)butanoic acid (CAS 24246-92-2) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 4-oxo-4-(phenacylamino)butanoic acid. InChIKey: DCAKUOVISGPERC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-oxo-4-(phenacylamino)butanoic acid |
| InChIKey | DCAKUOVISGPERC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)