CAS 2433776-55-5 appears in our catalog under these names: Etomidate Impurity 7, (R)-5-(Ethoxycarbonyl)-1-(1-phenylethyl)-1H-imidazole 3-oxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 1-oxido-3-[(1R)-1-phenylethyl]imidazol-1-ium-4-carboxylate (CAS 2433776-55-5) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: ethyl 1-oxido-3-[(1R)-1-phenylethyl]imidazol-1-ium-4-carboxylate. InChIKey: RPDYKYAQGAJLKM-LLVKDONJSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | ethyl 1-oxido-3-[(1R)-1-phenylethyl]imidazol-1-ium-4-carboxylate |
| InChIKey | RPDYKYAQGAJLKM-LLVKDONJSA-N |
| SMILES | CCOC(=O)C1=C[N+](=CN1[C@H](C)C2=CC=CC=C2)[O-] |
Computed by PubChem (NCBI)