Products 2438162-39-9

CAS 2438162-39-9 is the registry number for 3-Chloro-5-(1,1-difluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-5-(1,1-difluoroethyl)benzoic acid (CAS 2438162-39-9) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 3-chloro-5-(1,1-difluoroethyl)benzoic acid. InChIKey: FZATZCHNFXGTKH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClF2O2
Molecular weight220.60 g/mol
IUPAC name3-chloro-5-(1,1-difluoroethyl)benzoic acid
InChIKeyFZATZCHNFXGTKH-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC(=C1)C(=O)O)Cl)(F)F

Computed by PubChem (NCBI)