CAS 2438162-39-9 is the registry number for 3-Chloro-5-(1,1-difluoroethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5-(1,1-difluoroethyl)benzoic acid (CAS 2438162-39-9) is a chemical compound with the molecular formula C9H7ClF2O2 and a molecular weight of 220.60 g/mol. IUPAC name: 3-chloro-5-(1,1-difluoroethyl)benzoic acid. InChIKey: FZATZCHNFXGTKH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2O2 |
|---|---|
| Molecular weight | 220.60 g/mol |
| IUPAC name | 3-chloro-5-(1,1-difluoroethyl)benzoic acid |
| InChIKey | FZATZCHNFXGTKH-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(=O)O)Cl)(F)F |
Computed by PubChem (NCBI)