CAS 2439-85-2 appears in our catalog under these names: 2–Bromoisoindoline–1,3–dione, 2-Bromoisoindoline-1,3-dione 95%, 2-Bromoisoindoline-1,3-dione, 95%, 2-Bromoisoindoline-1,3-dione, 95%, 95%, N-Bromophthalimide/ 98+%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 10g, 25g, 500g, 5g, 1g, 50g, 250g.
2-bromoisoindole-1,3-dione (CAS 2439-85-2) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromoisoindole-1,3-dione. InChIKey: MARXMDRWROUXMD-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromoisoindole-1,3-dione |
| InChIKey | MARXMDRWROUXMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)Br |
Computed by PubChem (NCBI)