Products 244264-57-1
CAS 244264-57-1 is the registry number for 2-(4-methoxyphenyl)-N-methyl-2-oxoacetamide. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-(4-methoxyphenyl)-N-methyl-2-oxoacetamide (CAS 244264-57-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(4-methoxyphenyl)-N-methyl-2-oxoacetamide. InChIKey: LFRNOQWLRGQVQN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-N-methyl-2-oxoacetamide |
| InChIKey | LFRNOQWLRGQVQN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)