Products 2445-80-9
CAS 2445-80-9 appears in our catalog under these names: 7,8-Dimethoxycoumarin, 7,8-Dimethoxycoumarin/ 99.82% (existing batch purity), Daphnetin dimethyl ether, 7,8-dimethoxycoumarin, 99.82% ,, 99.82% ,, 7,8-Dimethoxycoumarin, 99.75%. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 20mg, 100mg, 1mg, 1 mg, 5 mg.
7,8-dimethoxychromen-2-one (CAS 2445-80-9) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 7,8-dimethoxychromen-2-one. InChIKey: CHBBSMUTOCUVDW-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 7,8-dimethoxychromen-2-one |
| InChIKey | CHBBSMUTOCUVDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=CC(=O)O2)OC |
Computed by PubChem (NCBI)