CAS 2449-05-0 appears in our catalog under these names: Dibenzyl Azodicarboxylate, Dibenzyl azodicarboxylate, Dibenzyl azodicarboxylate, 96% , Dibenzyl azodicarboxylate, 94%, Dibenzyl diazene-1,2-dicarboxylate 96%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 100mg, 1g, 5g, 100g, 25g, 50g, 250g, 500g.
Benzyl N-phenylmethoxycarbonyliminocarbamate (CAS 2449-05-0) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: benzyl N-phenylmethoxycarbonyliminocarbamate. InChIKey: IRJKSAIGIYODAN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | benzyl N-phenylmethoxycarbonyliminocarbamate |
| InChIKey | IRJKSAIGIYODAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N=NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)