Products 2449095-23-0
CAS 2449095-23-0 is the registry number for Ethyl (2E)-2-cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl (E)-2-cyano-3-(1-phenylindol-3-yl)prop-2-enoate (CAS 2449095-23-0) is a chemical compound with the molecular formula C20H16N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(1-phenylindol-3-yl)prop-2-enoate. InChIKey: VNSXFPLUPLKEPN-NTCAYCPXSA-N.
| Molecular formula | C20H16N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(1-phenylindol-3-yl)prop-2-enoate |
| InChIKey | VNSXFPLUPLKEPN-NTCAYCPXSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CN(C2=CC=CC=C21)C3=CC=CC=C3)/C#N |
Computed by PubChem (NCBI)