CAS 2452407-68-8 appears in our catalog under these names: Donepezil Alkene Pyridine N-Oxide, Donepezil Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethoxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]inden-1-one (CAS 2452407-68-8) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 5,6-dimethoxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]inden-1-one. InChIKey: SJNSMDISUUFMPX-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 5,6-dimethoxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]inden-1-one |
| InChIKey | SJNSMDISUUFMPX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(C2=O)CC3=CC=[N+](C=C3)[O-])OC |
Computed by PubChem (NCBI)