CAS 24539-28-4 appears in our catalog under these names: 4–METHOXYCARBONYLCUBANECARBOXYLIC ACID, 4-Methoxycarbonylcubanecarboxylic acid, 4-Methoxycarbonylcubanecarboxylic acid 98%, 4-Methoxycarbonylcubanecarboxylic acid, 98.0%, 4-Methoxycarbonylcubanecarboxylic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 0,1g, 0,5g, 0,25g, 2g, 100mg.
4-methoxycarbonylcubane-1-carboxylic acid (CAS 24539-28-4) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: 4-methoxycarbonylcubane-1-carboxylic acid. InChIKey: ARRJEFLYRAVFJA-UHFFFAOYSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 4-methoxycarbonylcubane-1-carboxylic acid |
| InChIKey | ARRJEFLYRAVFJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)O |
Computed by PubChem (NCBI)