Products 2460687-71-0
CAS 2460687-71-0 appears in our catalog under these names: Benzyl (S)–(1–(4–nitro–1H–pyrazol–1–yl)propan–2–yl)carbamate, Benzyl (S)-(1-(4-nitro-1H-pyrazol-1-yl)propan-2-yl)carbamate, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g.
Benzyl N-[(2S)-1-(4-nitropyrazol-1-yl)propan-2-yl]carbamate (CAS 2460687-71-0) is a chemical compound with the molecular formula C14H16N4O4 and a molecular weight of 304.30 g/mol. IUPAC name: benzyl N-[(2S)-1-(4-nitropyrazol-1-yl)propan-2-yl]carbamate. InChIKey: KAPRPWVZYHKXMA-NSHDSACASA-N.
| Molecular formula | C14H16N4O4 |
|---|---|
| Molecular weight | 304.30 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(4-nitropyrazol-1-yl)propan-2-yl]carbamate |
| InChIKey | KAPRPWVZYHKXMA-NSHDSACASA-N |
| SMILES | C[C@@H](CN1C=C(C=N1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)