CAS 24631-87-6 appears in our catalog under these names: 4-Hydroxy-5-methyl-2H-chromen-2-one, 97%, 4-Hydroxy-5-methyl Coumarin. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-5-methylchromen-2-one (CAS 24631-87-6) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 4-hydroxy-5-methylchromen-2-one. InChIKey: SGMVRLBDQDWGRZ-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-hydroxy-5-methylchromen-2-one |
| InChIKey | SGMVRLBDQDWGRZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)OC(=O)C=C2O |
Computed by PubChem (NCBI)