CAS 24672-91-1 is the registry number for 4-Chloro-3-ethoxy-1H-2-benzopyran-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
4-chloro-3-ethoxyisochromen-1-one (CAS 24672-91-1) is a chemical compound with the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. IUPAC name: 4-chloro-3-ethoxyisochromen-1-one. InChIKey: OPIOPBBMUTWYPB-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO3 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-chloro-3-ethoxyisochromen-1-one |
| InChIKey | OPIOPBBMUTWYPB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=CC=CC=C2C(=O)O1)Cl |
Computed by PubChem (NCBI)